C24H26N2 — CID 144943706
6-[2-(3-cyclopropylphenyl)-4-methylcyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydroquinoxaline (PubChem CID 144943706) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is 6-[2-(3-cyclopropylphenyl)-4-methylcyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6-[2-(3-cyclopropylphenyl)-4-methylcyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 144943706 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 6-[2-(3-cyclopropylphenyl)-4-methylcyclohexa-1,5-dien-1-yl]-1,2,3,4-tetrahydroquinoxaline |
| SMILES | CC1C=CC(c2ccc3c(c2)NCCN3)=C(c2cccc(C3CC3)c2)C1 |
| InChI | InChI=1S/C24H26N2/c1-16-5-9-21(20-8-10-23-24(15-20)26-12-11-25-23)22(13-16)19-4-2-3-18(14-19)17-6-7-17/h2-5,8-10,14-17,25-26H,6-7,11-13H2,1H3 |
| InChIKey | FWVBLCYVQFGLJN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|