About 2,4-diazido-6-ethoxy-1,3,5-triazine
2,4-diazido-6-ethoxy-1,3,5-triazine (PubChem CID 14494375) has the molecular formula C5H5N9O
and a molecular weight of 207.16 g/mol. Its IUPAC name is 2,4-diazido-6-ethoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-diazido-6-ethoxy-1,3,5-triazine |
| PubChem CID | 14494375 |
| Molecular Formula | C5H5N9O |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2,4-diazido-6-ethoxy-1,3,5-triazine |
| SMILES | CCOc1nc(N=[N+]=[N-])nc(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C5H5N9O/c1-2-15-5-9-3(11-13-6)8-4(10-5)12-14-7/h2H2,1H3 |
| InChIKey | YLNZGVHZZGZSQA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 145.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diazido-6-ethoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diazido-6-ethoxy-1,3,5-triazine?
The IUPAC name of 2,4-diazido-6-ethoxy-1,3,5-triazine (CID 14494375) is 2,4-diazido-6-ethoxy-1,3,5-triazine.
What is the SMILES notation for 2,4-diazido-6-ethoxy-1,3,5-triazine?
The canonical SMILES for 2,4-diazido-6-ethoxy-1,3,5-triazine is CCOc1nc(N=[N+]=[N-])nc(N=[N+]=[N-])n1.
What is the InChIKey of 2,4-diazido-6-ethoxy-1,3,5-triazine?
The InChIKey is YLNZGVHZZGZSQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N9O/c1-2-15-5-9-3(11-13-6)8-4(10-5)12-14-7/h2H2,1H3.
What are the key properties of 2,4-diazido-6-ethoxy-1,3,5-triazine?
2,4-diazido-6-ethoxy-1,3,5-triazine has a molecular weight of 207.16 g/mol, XLogP of 2.15, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diazido-6-ethoxy-1,3,5-triazine is sourced from PubChem (CID 14494375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).