C30H41F3N6 — CID 144943991
7-cyclohexyl-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N-(6,6,6-trifluorohexyl)pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 144943991) has the molecular formula C30H41F3N6 and a molecular weight of 542.69 g/mol. Its IUPAC name is 7-cyclohexyl-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N-(6,6,6-trifluorohexyl)pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 7-cyclohexyl-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N-(6,6,6-trifluorohexyl)pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 144943991 |
| Molecular Formula | C30H41F3N6 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.33 |
| IUPAC Name | 7-cyclohexyl-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-N-(6,6,6-trifluorohexyl)pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CN1CCN(Cc2ccc(-c3cn(C4CCCCC4)c4nc(NCCCCCC(F)(F)F)ncc34)cc2)CC1 |
| InChI | InChI=1S/C30H41F3N6/c1-37-16-18-38(19-17-37)21-23-10-12-24(13-11-23)27-22-39(25-8-4-2-5-9-25)28-26(27)20-35-29(36-28)34-15-7-3-6-14-30(31,32)33/h10-13,20,22,25H,2-9,14-19,21H2,1H3,(H,34,35,36) |
| InChIKey | HMOJFLNHKBMPFB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|