C25H36O2 — CID 144944458
2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylnona-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene (PubChem CID 144944458) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylnona-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene.
| Compound Name | 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylnona-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144944458 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 2-[[(3E,5E)-5-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,7-dimethylnona-3,5-dien-4-yl]oxymethyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C)COC(=C/C(C)CC)/C(=C\C(C)C)OCC1=CCCC=C1 |
| InChI | InChI=1S/C25H36O2/c1-7-13-22(9-3)18-26-25(17-21(6)8-2)24(16-20(4)5)27-19-23-14-11-10-12-15-23/h7,9,11,13-17,20-21H,1,3,8,10,12,18-19H2,2,4-6H3/b22-13+,24-16+,25-17+ |
| InChIKey | JWCWGEOHUWUGDP-HIKXFUELSA-N |
| XLogP | 7.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|