C26H38O2 — CID 144944474
2-[[(4E,6E)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-3,8-dimethyldeca-4,6-dien-5-yl]oxymethyl]cyclohexa-1,3-diene (PubChem CID 144944474) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is 2-[[(4E,6E)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-3,8-dimethyldeca-4,6-dien-5-yl]oxymethyl]cyclohexa-1,3-diene.
| Compound Name | 2-[[(4E,6E)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-3,8-dimethyldeca-4,6-dien-5-yl]oxymethyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 144944474 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2-[[(4E,6E)-6-[(2E)-2-ethenylpenta-2,4-dienoxy]-3,8-dimethyldeca-4,6-dien-5-yl]oxymethyl]cyclohexa-1,3-diene |
| SMILES | C=C/C=C(\C=C)COC(=C/C(C)CC)/C(=C\C(C)CC)OCC1=CCCC=C1 |
| InChI | InChI=1S/C26H38O2/c1-7-14-23(10-4)19-27-25(17-21(5)8-2)26(18-22(6)9-3)28-20-24-15-12-11-13-16-24/h7,10,12,14-18,21-22H,1,4,8-9,11,13,19-20H2,2-3,5-6H3/b23-14+,25-17+,26-18+ |
| InChIKey | QSRFBCPAHFRXHN-NKBHVVHZSA-N |
| XLogP | 7.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|