C29H49NO — CID 144944588
(5aR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol (PubChem CID 144944588) has the molecular formula C29H49NO and a molecular weight of 427.72 g/mol. Its IUPAC name is (5aR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol.
| Compound Name | (5aR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
|---|---|
| PubChem CID | 144944588 |
| Molecular Formula | C29H49NO |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 427.38 |
| IUPAC Name | (5aR)-3a-amino-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| SMILES | C=C(C)C1CCC2(N)CC[C@]3(C)C(CCC4C5(C)CCC(O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C29H49NO/c1-18(2)19-10-15-29(30)17-16-27(6)20(24(19)29)8-9-22-26(5)13-12-23(31)25(3,4)21(26)11-14-28(22,27)7/h19-24,31H,1,8-17,30H2,2-7H3/t19?,20?,21?,22?,23?,24?,26?,27-,28?,29?/m1/s1 |
| InChIKey | YZKRRTNOZRABSH-XFKJCBJTSA-N |
| XLogP | 6.72 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|