C20H20FNO3S — CID 144945271
(4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-thiazolidin-2-one (PubChem CID 144945271) has the molecular formula C20H20FNO3S and a molecular weight of 373.45 g/mol. Its IUPAC name is (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-thiazolidin-2-one.
| Compound Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 144945271 |
| Molecular Formula | C20H20FNO3S |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | (4S)-3-[(5S)-5-(4-fluorophenyl)-5-hydroxypentanoyl]-4-phenyl-1,3-thiazolidin-2-one |
| SMILES | O=C(CCC[C@H](O)c1ccc(F)cc1)N1C(=O)SC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20FNO3S/c21-16-11-9-15(10-12-16)18(23)7-4-8-19(24)22-17(13-26-20(22)25)14-5-2-1-3-6-14/h1-3,5-6,9-12,17-18,23H,4,7-8,13H2/t17-,18+/m1/s1 |
| InChIKey | WLIBFDSHJBZGOD-MSOLQXFVSA-N |
| XLogP | 4.47 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|