About ethane;spiro[3.5]non-7-ene
ethane;spiro[3.5]non-7-ene (PubChem CID 144945784) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is ethane;spiro[3.5]non-7-ene.
Molecular Properties
| Compound Name | ethane;spiro[3.5]non-7-ene |
| PubChem CID | 144945784 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | ethane;spiro[3.5]non-7-ene |
| SMILES | C1=CCC2(CC1)CCC2.CC |
| InChI | InChI=1S/C9H14.C2H6/c1-2-5-9(6-3-1)7-4-8-9;1-2/h1-2H,3-8H2;1-2H3 |
| InChIKey | PXODFUHFNKTNQX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;spiro[3.5]non-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;spiro[3.5]non-7-ene?
The IUPAC name of ethane;spiro[3.5]non-7-ene (CID 144945784) is ethane;spiro[3.5]non-7-ene.
What is the SMILES notation for ethane;spiro[3.5]non-7-ene?
The canonical SMILES for ethane;spiro[3.5]non-7-ene is C1=CCC2(CC1)CCC2.CC.
What is the InChIKey of ethane;spiro[3.5]non-7-ene?
The InChIKey is PXODFUHFNKTNQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14.C2H6/c1-2-5-9(6-3-1)7-4-8-9;1-2/h1-2H,3-8H2;1-2H3.
What are the key properties of ethane;spiro[3.5]non-7-ene?
ethane;spiro[3.5]non-7-ene has a molecular weight of 152.28 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;spiro[3.5]non-7-ene is sourced from PubChem (CID 144945784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).