About 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol
2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol (PubChem CID 144945979) has the molecular formula C12H19ClO2
and a molecular weight of 230.73 g/mol. Its IUPAC name is 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol.
Molecular Properties
| Compound Name | 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol |
| PubChem CID | 144945979 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol |
| SMILES | C/C(Cl)=C\C=C(/C)CC1CC(O)CCO1 |
| InChI | InChI=1S/C12H19ClO2/c1-9(3-4-10(2)13)7-12-8-11(14)5-6-15-12/h3-4,11-12,14H,5-8H2,1-2H3/b9-3+,10-4+ |
| InChIKey | TYEUTRRBGFAYSX-LQIBPGRFSA-N |
| XLogP | 3.01 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol?
The IUPAC name of 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol (CID 144945979) is 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol.
What is the SMILES notation for 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol?
The canonical SMILES for 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol is C/C(Cl)=C\C=C(/C)CC1CC(O)CCO1.
What is the InChIKey of 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol?
The InChIKey is TYEUTRRBGFAYSX-LQIBPGRFSA-N. The full InChI is InChI=1S/C12H19ClO2/c1-9(3-4-10(2)13)7-12-8-11(14)5-6-15-12/h3-4,11-12,14H,5-8H2,1-2H3/b9-3+,10-4+.
What are the key properties of 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol?
2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol has a molecular weight of 230.73 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2E,4E)-5-chloro-2-methylhexa-2,4-dienyl]oxan-4-ol is sourced from PubChem (CID 144945979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).