C15H17F3O3S — CID 144946017
4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carboxylic acid (PubChem CID 144946017) has the molecular formula C15H17F3O3S and a molecular weight of 334.36 g/mol. Its IUPAC name is 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carboxylic acid.
| Compound Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 144946017 |
| Molecular Formula | C15H17F3O3S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carboxylic acid |
| SMILES | CCC1(Sc2cccc(C(F)(F)F)c2)CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C15H17F3O3S/c1-2-14(6-7-21-12(9-14)13(19)20)22-11-5-3-4-10(8-11)15(16,17)18/h3-5,8,12H,2,6-7,9H2,1H3,(H,19,20) |
| InChIKey | UUHAEBWILTYXLO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |