About 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol
4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol (PubChem CID 144946060) has the molecular formula C16H21F3O3S
and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol.
Molecular Properties
| Compound Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol |
| PubChem CID | 144946060 |
| Molecular Formula | C16H21F3O3S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol |
| SMILES | CCC1(Sc2cccc(C(F)(F)F)c2)CCOC(C=O)C1.CO |
| InChI | InChI=1S/C15H17F3O2S.CH4O/c1-2-14(6-7-20-12(9-14)10-19)21-13-5-3-4-11(8-13)15(16,17)18;1-2/h3-5,8,10,12H,2,6-7,9H2,1H3;2H,1H3 |
| InChIKey | JIOQPKUSBKLPTD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol?
The IUPAC name of 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol (CID 144946060) is 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol.
What is the SMILES notation for 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol?
The canonical SMILES for 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol is CCC1(Sc2cccc(C(F)(F)F)c2)CCOC(C=O)C1.CO.
What is the InChIKey of 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol?
The InChIKey is JIOQPKUSBKLPTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3O2S.CH4O/c1-2-14(6-7-20-12(9-14)10-19)21-13-5-3-4-11(8-13)15(16,17)18;1-2/h3-5,8,10,12H,2,6-7,9H2,1H3;2H,1H3.
What are the key properties of 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol?
4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol has a molecular weight of 350.40 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxane-2-carbaldehyde;methanol is sourced from PubChem (CID 144946060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).