C40H61ClFN3O3 — CID 144946220
1-[2-[[(4E,6E)-7-chloro-2,3-dimethylocta-2,4,6-trien-4-yl]-(4-fluorobutyl)amino]-3-methylbut-2-enyl]-3-ethyl-3-(2-methylbutyl)indol-2-one;N-(3-hydroxycyclobutyl)acetamide (PubChem CID 144946220) has the molecular formula C40H61ClFN3O3 and a molecular weight of 686.40 g/mol. Its IUPAC name is 1-[2-[[(4E,6E)-7-chloro-2,3-dimethylocta-2,4,6-trien-4-yl]-(4-fluorobutyl)amino]-3-methylbut-2-enyl]-3-ethyl-3-(2-methylbutyl)indol-2-one;N-(3-hydroxycyclobutyl)acetamide.
| Compound Name | 1-[2-[[(4E,6E)-7-chloro-2,3-dimethylocta-2,4,6-trien-4-yl]-(4-fluorobutyl)amino]-3-methylbut-2-enyl]-3-ethyl-3-(2-methylbutyl)indol-2-one;N-(3-hydroxycyclobutyl)acetamide |
|---|---|
| PubChem CID | 144946220 |
| Molecular Formula | C40H61ClFN3O3 |
| Molecular Weight | 686.40 g/mol |
| Exact Mass | 685.44 |
| IUPAC Name | 1-[2-[[(4E,6E)-7-chloro-2,3-dimethylocta-2,4,6-trien-4-yl]-(4-fluorobutyl)amino]-3-methylbut-2-enyl]-3-ethyl-3-(2-methylbutyl)indol-2-one;N-(3-hydroxycyclobutyl)acetamide |
| SMILES | CC(=O)NC1CC(O)C1.CCC(C)CC1(CC)C(=O)N(CC(=C(C)C)N(CCCCF)/C(=C/C=C(\C)Cl)C(C)=C(C)C)c2ccccc21 |
| InChI | InChI=1S/C34H50ClFN2O.C6H11NO2/c1-10-26(7)22-34(11-2)29-16-12-13-17-31(29)38(33(34)39)23-32(25(5)6)37(21-15-14-20-36)30(19-18-27(8)35)28(9)24(3)4;1-4(8)7-5-2-6(9)3-5/h12-13,16-19,26H,10-11,14-15,20-23H2,1-9H3;5-6,9H,2-3H2,1H3,(H,7,8)/b27-18+,30-19+; |
| InChIKey | PVEWIENGTUCHLU-RGSKOWSPSA-N |
| XLogP | 9.49 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.40 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|