About 5,10,10-trimethylbenzo[b][1,4]benzazasiline
5,10,10-trimethylbenzo[b][1,4]benzazasiline (PubChem CID 14494633) has the molecular formula C15H17NSi
and a molecular weight of 239.39 g/mol. Its IUPAC name is 5,10,10-trimethylbenzo[b][1,4]benzazasiline.
Molecular Properties
| Compound Name | 5,10,10-trimethylbenzo[b][1,4]benzazasiline |
| PubChem CID | 14494633 |
| Molecular Formula | C15H17NSi |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 5,10,10-trimethylbenzo[b][1,4]benzazasiline |
| SMILES | CN1c2ccccc2[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H17NSi/c1-16-12-8-4-6-10-14(12)17(2,3)15-11-7-5-9-13(15)16/h4-11H,1-3H3 |
| InChIKey | HULHKHNSMOSMDV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5,10,10-trimethylbenzo[b][1,4]benzazasiline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10,10-trimethylbenzo[b][1,4]benzazasiline?
The IUPAC name of 5,10,10-trimethylbenzo[b][1,4]benzazasiline (CID 14494633) is 5,10,10-trimethylbenzo[b][1,4]benzazasiline.
What is the SMILES notation for 5,10,10-trimethylbenzo[b][1,4]benzazasiline?
The canonical SMILES for 5,10,10-trimethylbenzo[b][1,4]benzazasiline is CN1c2ccccc2[Si](C)(C)c2ccccc21.
What is the InChIKey of 5,10,10-trimethylbenzo[b][1,4]benzazasiline?
The InChIKey is HULHKHNSMOSMDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NSi/c1-16-12-8-4-6-10-14(12)17(2,3)15-11-7-5-9-13(15)16/h4-11H,1-3H3.
What are the key properties of 5,10,10-trimethylbenzo[b][1,4]benzazasiline?
5,10,10-trimethylbenzo[b][1,4]benzazasiline has a molecular weight of 239.39 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10,10-trimethylbenzo[b][1,4]benzazasiline is sourced from PubChem (CID 14494633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).