C6F9NO — CID 14494661
5-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,3-oxazole (PubChem CID 14494661) has the molecular formula C6F9NO and a molecular weight of 273.05 g/mol. Its IUPAC name is 5-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,3-oxazole.
| Compound Name | 5-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,3-oxazole |
|---|---|
| PubChem CID | 14494661 |
| Molecular Formula | C6F9NO |
| Molecular Weight | 273.05 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 5-fluoro-2-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,3-oxazole |
| SMILES | Fc1oc(C(F)(F)C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C6F9NO/c7-2-1(5(10,11)12)16-3(17-2)4(8,9)6(13,14)15 |
| InChIKey | QZNRBEGQHMXXRG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.05 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|