C42H26FN7O — CID 144946714
6-(9,9-dimethylacridin-10-yl)-3-fluoro-10-phenoxazin-10-ylpyrazino[2,3-f][1,10]phenanthroline-2-carbonitrile (PubChem CID 144946714) has the molecular formula C42H26FN7O and a molecular weight of 663.72 g/mol. Its IUPAC name is 6-(9,9-dimethylacridin-10-yl)-3-fluoro-10-phenoxazin-10-ylpyrazino[2,3-f][1,10]phenanthroline-2-carbonitrile.
| Compound Name | 6-(9,9-dimethylacridin-10-yl)-3-fluoro-10-phenoxazin-10-ylpyrazino[2,3-f][1,10]phenanthroline-2-carbonitrile |
|---|---|
| PubChem CID | 144946714 |
| Molecular Formula | C42H26FN7O |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 6-(9,9-dimethylacridin-10-yl)-3-fluoro-10-phenoxazin-10-ylpyrazino[2,3-f][1,10]phenanthroline-2-carbonitrile |
| SMILES | CC1(C)c2ccccc2N(c2cnc3c(c2)c2nc(F)c(C#N)nc2c2ccc(N4c5ccccc5Oc5ccccc54)nc23)c2ccccc21 |
| InChI | InChI=1S/C42H26FN7O/c1-42(2)27-11-3-5-13-30(27)49(31-14-6-4-12-28(31)42)24-21-26-37(45-23-24)38-25(39-40(26)48-41(43)29(22-44)46-39)19-20-36(47-38)50-32-15-7-9-17-34(32)51-35-18-10-8-16-33(35)50/h3-21,23H,1-2H3 |
| InChIKey | WSOIIYHRJUVTNK-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 91.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|