C20H19Cl2N7O3 — CID 144947274
N-[(3S,4S)-1-(3-amino-1,2-benzoxazol-7-yl)-4-hydroxypyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide (PubChem CID 144947274) has the molecular formula C20H19Cl2N7O3 and a molecular weight of 476.32 g/mol. Its IUPAC name is N-[(3S,4S)-1-(3-amino-1,2-benzoxazol-7-yl)-4-hydroxypyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide.
| Compound Name | N-[(3S,4S)-1-(3-amino-1,2-benzoxazol-7-yl)-4-hydroxypyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide |
|---|---|
| PubChem CID | 144947274 |
| Molecular Formula | C20H19Cl2N7O3 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[(3S,4S)-1-(3-amino-1,2-benzoxazol-7-yl)-4-hydroxypyrrolidin-3-yl]-2,6-dichloro-4-(dimethanimidoylamino)benzamide |
| SMILES | [H]/N=C/N(/C=N/[H])c1cc(Cl)c(C(=O)N[C@H]2CN(c3cccc4c(N)noc34)C[C@@H]2O)c(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N7O3/c21-12-4-10(29(8-23)9-24)5-13(22)17(12)20(31)26-14-6-28(7-16(14)30)15-3-1-2-11-18(15)32-27-19(11)25/h1-5,8-9,14,16,23-24,30H,6-7H2,(H2,25,27)(H,26,31)/b23-8+,24-9+/t14-,16-/m0/s1 |
| InChIKey | MZGIYESGXWZDDL-PHPIEBBUSA-N |
| XLogP | 2.72 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|