C16H21N3O4 — CID 144947805
ethane;3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione (PubChem CID 144947805) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is ethane;3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 144947805 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethane;3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\N=C1\C(=O)N(C2CCC(=O)NC2=O)C(=O)\C1=C\C.CC |
| InChI | InChI=1S/C14H15N3O4.C2H6/c1-3-7-15-11-8(4-2)13(20)17(14(11)21)9-5-6-10(18)16-12(9)19;1-2/h3-4,7,9H,5-6H2,1-2H3,(H,16,18,19);1-2H3/b7-3-,8-4+,15-11+; |
| InChIKey | DGUKDNUWXDIKCK-YEIBRDHESA-N |
| XLogP | 1.11 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|