C14H15N3O4 — CID 144947806
3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione (PubChem CID 144947806) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is 3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 144947806 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[(3E)-3-ethylidene-2,5-dioxo-4-[(Z)-prop-1-enyl]iminopyrrolidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\N=C1\C(=O)N(C2CCC(=O)NC2=O)C(=O)\C1=C\C |
| InChI | InChI=1S/C14H15N3O4/c1-3-7-15-11-8(4-2)13(20)17(14(11)21)9-5-6-10(18)16-12(9)19/h3-4,7,9H,5-6H2,1-2H3,(H,16,18,19)/b7-3-,8-4+,15-11+ |
| InChIKey | LSGYFWCYNNDRAX-AVXKTZCDSA-N |
| XLogP | 0.08 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|