About 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen
2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen (PubChem CID 144947828) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen |
| PubChem CID | 144947828 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen |
| SMILES | CC.CCC(C(=O)NC)N1C(=O)Cc2ccccc2C1=O.[H][H] |
| InChI | InChI=1S/C14H16N2O3.C2H6.H2/c1-3-11(13(18)15-2)16-12(17)8-9-6-4-5-7-10(9)14(16)19;1-2;/h4-7,11H,3,8H2,1-2H3,(H,15,18);1-2H3;1H |
| InChIKey | XPHOKCHXPMQFGR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen?
The IUPAC name of 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen (CID 144947828) is 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen.
What is the SMILES notation for 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen?
The canonical SMILES for 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen is CC.CCC(C(=O)NC)N1C(=O)Cc2ccccc2C1=O.[H][H].
What is the InChIKey of 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen?
The InChIKey is XPHOKCHXPMQFGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3.C2H6.H2/c1-3-11(13(18)15-2)16-12(17)8-9-6-4-5-7-10(9)14(16)19;1-2;/h4-7,11H,3,8H2,1-2H3,(H,15,18);1-2H3;1H.
What are the key properties of 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen?
2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen has a molecular weight of 292.38 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-4H-isoquinolin-2-yl)-N-methylbutanamide;ethane;molecular hydrogen is sourced from PubChem (CID 144947828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).