C16H21N3O4 — CID 144947840
5-[(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-2-oxopyrrolidin-1-yl]-1,3-diazinane-2,4,6-trione;ethane (PubChem CID 144947840) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-2-oxopyrrolidin-1-yl]-1,3-diazinane-2,4,6-trione;ethane.
| Compound Name | 5-[(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-2-oxopyrrolidin-1-yl]-1,3-diazinane-2,4,6-trione;ethane |
|---|---|
| PubChem CID | 144947840 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5-[(3E,4E)-3-[(Z)-but-2-enylidene]-4-ethylidene-2-oxopyrrolidin-1-yl]-1,3-diazinane-2,4,6-trione;ethane |
| SMILES | C/C=C\C=C1\C(=O)N(C2C(=O)NC(=O)NC2=O)C\C1=C\C.CC |
| InChI | InChI=1S/C14H15N3O4.C2H6/c1-3-5-6-9-8(4-2)7-17(13(9)20)10-11(18)15-14(21)16-12(10)19;1-2/h3-6,10H,7H2,1-2H3,(H2,15,16,18,19,21);1-2H3/b5-3-,8-4-,9-6+; |
| InChIKey | RHZGTQDOULMBJC-ASNDAQBLSA-N |
| XLogP | 1.04 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|