C37H39NO4S — CID 144948738
N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-methyl-3-(3-methylbut-2-en-2-yl)benzamide;2-(4-ethylphenyl)benzenecarbothioic S-acid (PubChem CID 144948738) has the molecular formula C37H39NO4S and a molecular weight of 593.79 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-methyl-3-(3-methylbut-2-en-2-yl)benzamide;2-(4-ethylphenyl)benzenecarbothioic S-acid.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-methyl-3-(3-methylbut-2-en-2-yl)benzamide;2-(4-ethylphenyl)benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 144948738 |
| Molecular Formula | C37H39NO4S |
| Molecular Weight | 593.79 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-4-methyl-3-(3-methylbut-2-en-2-yl)benzamide;2-(4-ethylphenyl)benzenecarbothioic S-acid |
| SMILES | CC(C)=C(C)c1cc(C(=O)NCC2COc3ccccc3O2)ccc1C.CCc1ccc(-c2ccccc2C(=O)S)cc1 |
| InChI | InChI=1S/C22H25NO3.C15H14OS/c1-14(2)16(4)19-11-17(10-9-15(19)3)22(24)23-12-18-13-25-20-7-5-6-8-21(20)26-18;1-2-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15(16)17/h5-11,18H,12-13H2,1-4H3,(H,23,24);3-10H,2H2,1H3,(H,16,17) |
| InChIKey | QDRYWCJLXSTMSA-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.79 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|