About N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline
N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline (PubChem CID 144949165) has the molecular formula C21H22BrN
and a molecular weight of 368.32 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline |
| PubChem CID | 144949165 |
| Molecular Formula | C21H22BrN |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C=C(\C(=C)C)N(c1ccc(Br)cc1)c1ccccc1CC |
| InChI | InChI=1S/C21H22BrN/c1-5-9-20(16(3)4)23(19-14-12-18(22)13-15-19)21-11-8-7-10-17(21)6-2/h5,7-15H,1,3,6H2,2,4H3/b20-9+ |
| InChIKey | RKNGYOPKFZRIPR-AWQFTUOYSA-N |
| XLogP | 6.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline?
The IUPAC name of N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline (CID 144949165) is N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline.
What is the SMILES notation for N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline?
The canonical SMILES for N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline is C=C/C=C(\C(=C)C)N(c1ccc(Br)cc1)c1ccccc1CC.
What is the InChIKey of N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline?
The InChIKey is RKNGYOPKFZRIPR-AWQFTUOYSA-N. The full InChI is InChI=1S/C21H22BrN/c1-5-9-20(16(3)4)23(19-14-12-18(22)13-15-19)21-11-8-7-10-17(21)6-2/h5,7-15H,1,3,6H2,2,4H3/b20-9+.
What are the key properties of N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline?
N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline has a molecular weight of 368.32 g/mol, XLogP of 6.80, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2-ethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline is sourced from PubChem (CID 144949165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).