C30H38O6 — CID 144949269
2-[(1R,3aS)-5'-(1-carboxyethenyl)-3a-hydroxy-8,8'-dimethylidene-2'-oxospiro[2,3,3b,4,5,6,7,8a,9,9a-decahydrocyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid (PubChem CID 144949269) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2-[(1R,3aS)-5'-(1-carboxyethenyl)-3a-hydroxy-8,8'-dimethylidene-2'-oxospiro[2,3,3b,4,5,6,7,8a,9,9a-decahydrocyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid.
| Compound Name | 2-[(1R,3aS)-5'-(1-carboxyethenyl)-3a-hydroxy-8,8'-dimethylidene-2'-oxospiro[2,3,3b,4,5,6,7,8a,9,9a-decahydrocyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144949269 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[(1R,3aS)-5'-(1-carboxyethenyl)-3a-hydroxy-8,8'-dimethylidene-2'-oxospiro[2,3,3b,4,5,6,7,8a,9,9a-decahydrocyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(=C)C2CC3[C@](O)(CC[C@]34C(=O)CC3C(=C)CCC(C(=C)C(=O)O)CC34)C2C1 |
| InChI | InChI=1S/C30H38O6/c1-15-5-8-20(18(4)28(34)35)12-24-21(15)13-25-29(9-10-30(24,25)36)23-11-19(17(3)27(32)33)7-6-16(2)22(23)14-26(29)31/h19-25,36H,1-14H2,(H,32,33)(H,34,35)/t19?,20?,21?,22?,23?,24?,25?,29-,30+/m1/s1 |
| InChIKey | UFBIWDBCAHMPAP-DKULQDJTSA-N |
| XLogP | 4.95 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|