C31H38O6 — CID 144949280
2-[(2S,8'aR,13R,16R)-16-methoxy-5,8',9-trimethylidene-2',4-dioxospiro[3-oxatetracyclo[8.6.0.02,6.012,16]hexadecane-13,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5'-yl]prop-2-enoic acid (PubChem CID 144949280) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-[(2S,8'aR,13R,16R)-16-methoxy-5,8',9-trimethylidene-2',4-dioxospiro[3-oxatetracyclo[8.6.0.02,6.012,16]hexadecane-13,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5'-yl]prop-2-enoic acid.
| Compound Name | 2-[(2S,8'aR,13R,16R)-16-methoxy-5,8',9-trimethylidene-2',4-dioxospiro[3-oxatetracyclo[8.6.0.02,6.012,16]hexadecane-13,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5'-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144949280 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-[(2S,8'aR,13R,16R)-16-methoxy-5,8',9-trimethylidene-2',4-dioxospiro[3-oxatetracyclo[8.6.0.02,6.012,16]hexadecane-13,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5'-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(=C)[C@@H]2CC(=O)[C@]3(CC[C@]4(OC)C5C(CC43)C(=C)CCC3C(=C)C(=O)O[C@@H]35)C2C1 |
| InChI | InChI=1S/C31H38O6/c1-15-6-8-19(17(3)28(33)34)12-23-21(15)14-25(32)30(23)10-11-31(36-5)24(30)13-22-16(2)7-9-20-18(4)29(35)37-27(20)26(22)31/h19-24,26-27H,1-4,6-14H2,5H3,(H,33,34)/t19?,20?,21-,22?,23?,24?,26?,27-,30+,31+/m0/s1 |
| InChIKey | RZINTKSZIKRIEY-QASSWDDOSA-N |
| XLogP | 5.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|