C31H40O5 — CID 144949289
2-[(5'R)-5'-(3-methoxy-3-oxoprop-1-en-2-yl)-8,8'-dimethylidene-2'-oxospiro[3,3a,3b,4,5,6,7,8a,9,9a-decahydro-2H-cyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid (PubChem CID 144949289) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is 2-[(5'R)-5'-(3-methoxy-3-oxoprop-1-en-2-yl)-8,8'-dimethylidene-2'-oxospiro[3,3a,3b,4,5,6,7,8a,9,9a-decahydro-2H-cyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid.
| Compound Name | 2-[(5'R)-5'-(3-methoxy-3-oxoprop-1-en-2-yl)-8,8'-dimethylidene-2'-oxospiro[3,3a,3b,4,5,6,7,8a,9,9a-decahydro-2H-cyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 144949289 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 2-[(5'R)-5'-(3-methoxy-3-oxoprop-1-en-2-yl)-8,8'-dimethylidene-2'-oxospiro[3,3a,3b,4,5,6,7,8a,9,9a-decahydro-2H-cyclopenta[a]azulene-1,3'-3a,4,5,6,7,8a-hexahydro-1H-azulene]-5-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCC(=C)C2CC3C(CCC34C(=O)CC3C(=C)CC[C@@H](C(=C)C(=O)OC)CC34)C2C1 |
| InChI | InChI=1S/C31H40O5/c1-16-6-8-20(18(3)29(33)34)12-25-22-10-11-31(27(22)14-23(16)25)26-13-21(19(4)30(35)36-5)9-7-17(2)24(26)15-28(31)32/h20-27H,1-4,6-15H2,5H3,(H,33,34)/t20?,21-,22?,23?,24?,25?,26?,27?,31?/m1/s1 |
| InChIKey | UUGDAWFVRJOHAV-NXXSVWHESA-N |
| XLogP | 5.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|