C16H28O — CID 144949863
(5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;ethane;2-methylprop-2-enal (PubChem CID 144949863) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;ethane;2-methylprop-2-enal.
| Compound Name | (5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;ethane;2-methylprop-2-enal |
|---|---|
| PubChem CID | 144949863 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptane;ethane;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.C=C1CC[C@H]2CC1C2(C)C.CC |
| InChI | InChI=1S/C10H16.C4H6O.C2H6/c1-7-4-5-8-6-9(7)10(8,2)3;1-4(2)3-5;1-2/h8-9H,1,4-6H2,2-3H3;3H,1H2,2H3;1-2H3/t8-,9?;;/m0../s1 |
| InChIKey | YNERKTLLDWHHEV-NWWUXDCXSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|