About (4S)-2,4,5-trimethyl-3,4-dihydropyrazole
(4S)-2,4,5-trimethyl-3,4-dihydropyrazole (PubChem CID 144949916) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (4S)-2,4,5-trimethyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | (4S)-2,4,5-trimethyl-3,4-dihydropyrazole |
| PubChem CID | 144949916 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (4S)-2,4,5-trimethyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(C)C[C@@H]1C |
| InChI | InChI=1S/C6H12N2/c1-5-4-8(3)7-6(5)2/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | UWCOGVAFZZBWAT-YFKPBYRVSA-N |
| XLogP | 0.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-2,4,5-trimethyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4,5-trimethyl-3,4-dihydropyrazole?
The IUPAC name of (4S)-2,4,5-trimethyl-3,4-dihydropyrazole (CID 144949916) is (4S)-2,4,5-trimethyl-3,4-dihydropyrazole.
What is the SMILES notation for (4S)-2,4,5-trimethyl-3,4-dihydropyrazole?
The canonical SMILES for (4S)-2,4,5-trimethyl-3,4-dihydropyrazole is CC1=NN(C)C[C@@H]1C.
What is the InChIKey of (4S)-2,4,5-trimethyl-3,4-dihydropyrazole?
The InChIKey is UWCOGVAFZZBWAT-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H12N2/c1-5-4-8(3)7-6(5)2/h5H,4H2,1-3H3/t5-/m0/s1.
What are the key properties of (4S)-2,4,5-trimethyl-3,4-dihydropyrazole?
(4S)-2,4,5-trimethyl-3,4-dihydropyrazole has a molecular weight of 112.18 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4,5-trimethyl-3,4-dihydropyrazole is sourced from PubChem (CID 144949916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).