C20H10F6O6 — CID 144950317
formyl 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoate (PubChem CID 144950317) has the molecular formula C20H10F6O6 and a molecular weight of 460.28 g/mol. Its IUPAC name is formyl 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoate.
| Compound Name | formyl 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 144950317 |
| Molecular Formula | C20H10F6O6 |
| Molecular Weight | 460.28 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | formyl 4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylbenzoate |
| SMILES | Cc1cc(C(c2ccc3c(c2)C(=O)OC3=O)(C(F)(F)F)C(F)(F)F)ccc1C(=O)OC=O |
| InChI | InChI=1S/C20H10F6O6/c1-9-6-10(2-4-12(9)15(28)31-8-27)18(19(21,22)23,20(24,25)26)11-3-5-13-14(7-11)17(30)32-16(13)29/h2-8H,1H3 |
| InChIKey | SORSPXBAILKTDS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|