About ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one
ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 144951341) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 144951341 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC.Cc1ccc(-c2ccc3[nH]c(=O)[nH]c3c2)o1 |
| InChI | InChI=1S/C12H10N2O2.C2H6/c1-7-2-5-11(16-7)8-3-4-9-10(6-8)14-12(15)13-9;1-2/h2-6H,1H3,(H2,13,14,15);1-2H3 |
| InChIKey | QBZVZWSQBBMNCP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one (CID 144951341) is ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one is CC.Cc1ccc(-c2ccc3[nH]c(=O)[nH]c3c2)o1.
What is the InChIKey of ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one?
The InChIKey is QBZVZWSQBBMNCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2.C2H6/c1-7-2-5-11(16-7)8-3-4-9-10(6-8)14-12(15)13-9;1-2/h2-6H,1H3,(H2,13,14,15);1-2H3.
What are the key properties of ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one?
ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one has a molecular weight of 244.29 g/mol, XLogP of 3.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-(5-methylfuran-2-yl)-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 144951341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).