C20H17N5O4S — CID 144951598
2-[[5-[3-(hydroxyamino)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 144951598) has the molecular formula C20H17N5O4S and a molecular weight of 423.45 g/mol. Its IUPAC name is 2-[[5-[3-(hydroxyamino)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[3-(hydroxyamino)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 144951598 |
| Molecular Formula | C20H17N5O4S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[[5-[3-(hydroxyamino)-5-(5-methyl-3-phenyl-1,2-oxazol-4-yl)phenyl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | Cc1onc(-c2ccccc2)c1-c1cc(NO)cc(-c2nc(SCC(=O)O)n[nH]2)c1 |
| InChI | InChI=1S/C20H17N5O4S/c1-11-17(18(25-29-11)12-5-3-2-4-6-12)13-7-14(9-15(8-13)24-28)19-21-20(23-22-19)30-10-16(26)27/h2-9,24,28H,10H2,1H3,(H,26,27)(H,21,22,23) |
| InChIKey | BDFRQFUQGLWFHD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 137.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|