C24H20N5O3S+ — CID 144951710
[3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(2-phenyl-1H-indol-5-yl)phenyl]-hydroxyazanium (PubChem CID 144951710) has the molecular formula C24H20N5O3S+ and a molecular weight of 458.52 g/mol. Its IUPAC name is [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(2-phenyl-1H-indol-5-yl)phenyl]-hydroxyazanium.
| Compound Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(2-phenyl-1H-indol-5-yl)phenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 144951710 |
| Molecular Formula | C24H20N5O3S+ |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-(2-phenyl-1H-indol-5-yl)phenyl]-hydroxyazanium |
| SMILES | O=C(O)CSc1n[nH]c(-c2cc([NH2+]O)cc(-c3ccc4[nH]c(-c5ccccc5)cc4c3)c2)n1 |
| InChI | InChI=1S/C24H19N5O3S/c30-22(31)13-33-24-26-23(27-28-24)18-9-16(10-19(11-18)29-32)15-6-7-20-17(8-15)12-21(25-20)14-4-2-1-3-5-14/h1-12,25,29,32H,13H2,(H,30,31)(H,26,27,28)/p+1 |
| InChIKey | CQUOLQVJGAQNRI-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|