C21H33N5O — CID 144952121
(1,5-dimethylpyrazol-4-yl)-[3-[(1Z)-1-[ethylamino(prop-1-en-2-yl)amino]-3-methylbuta-1,3-dienyl]piperidin-1-yl]methanone (PubChem CID 144952121) has the molecular formula C21H33N5O and a molecular weight of 371.53 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-4-yl)-[3-[(1Z)-1-[ethylamino(prop-1-en-2-yl)amino]-3-methylbuta-1,3-dienyl]piperidin-1-yl]methanone.
| Compound Name | (1,5-dimethylpyrazol-4-yl)-[3-[(1Z)-1-[ethylamino(prop-1-en-2-yl)amino]-3-methylbuta-1,3-dienyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 144952121 |
| Molecular Formula | C21H33N5O |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | (1,5-dimethylpyrazol-4-yl)-[3-[(1Z)-1-[ethylamino(prop-1-en-2-yl)amino]-3-methylbuta-1,3-dienyl]piperidin-1-yl]methanone |
| SMILES | C=C(C)/C=C(/C1CCCN(C(=O)c2cnn(C)c2C)C1)N(NCC)C(=C)C |
| InChI | InChI=1S/C21H33N5O/c1-8-22-26(16(4)5)20(12-15(2)3)18-10-9-11-25(14-18)21(27)19-13-23-24(7)17(19)6/h12-13,18,22H,2,4,8-11,14H2,1,3,5-7H3/b20-12- |
| InChIKey | CKLZYYSUGDTVNK-NDENLUEZSA-N |
| XLogP | 3.40 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|