C20H28N6O3S — CID 144953178
4-[5-[5-[[6-[(E)-ethoxyiminomethyl]-3-pyridinyl]oxy]pentyl]-1-oxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine (PubChem CID 144953178) has the molecular formula C20H28N6O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[5-[5-[[6-[(E)-ethoxyiminomethyl]-3-pyridinyl]oxy]pentyl]-1-oxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine.
| Compound Name | 4-[5-[5-[[6-[(E)-ethoxyiminomethyl]-3-pyridinyl]oxy]pentyl]-1-oxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 144953178 |
| Molecular Formula | C20H28N6O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-[5-[5-[[6-[(E)-ethoxyiminomethyl]-3-pyridinyl]oxy]pentyl]-1-oxo-1,2,5-thiadiazolidin-2-yl]pyridin-2-amine |
| SMILES | CCO/N=C/c1ccc(OCCCCCN2CCN(c3ccnc(N)c3)S2=O)cn1 |
| InChI | InChI=1S/C20H28N6O3S/c1-2-29-24-15-17-6-7-19(16-23-17)28-13-5-3-4-10-25-11-12-26(30(25)27)18-8-9-22-20(21)14-18/h6-9,14-16H,2-5,10-13H2,1H3,(H2,21,22)/b24-15+ |
| InChIKey | XQNOMKOBNULIDE-BUVRLJJBSA-N |
| XLogP | 2.38 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|