C60H38N6OS — CID 144953430
2-(3-dibenzofuran-4-ylphenyl)-4,6-diphenyl-1,3,5-triazine;2-dibenzothiophen-4-yl-4,6-diphenyl-1,3,5-triazine (PubChem CID 144953430) has the molecular formula C60H38N6OS and a molecular weight of 891.07 g/mol. Its IUPAC name is 2-(3-dibenzofuran-4-ylphenyl)-4,6-diphenyl-1,3,5-triazine;2-dibenzothiophen-4-yl-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(3-dibenzofuran-4-ylphenyl)-4,6-diphenyl-1,3,5-triazine;2-dibenzothiophen-4-yl-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 144953430 |
| Molecular Formula | C60H38N6OS |
| Molecular Weight | 891.07 g/mol |
| Exact Mass | 890.28 |
| IUPAC Name | 2-(3-dibenzofuran-4-ylphenyl)-4,6-diphenyl-1,3,5-triazine;2-dibenzothiophen-4-yl-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc5c4oc4ccccc45)c3)n2)cc1.c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3sc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C33H21N3O.C27H17N3S/c1-3-11-22(12-4-1)31-34-32(23-13-5-2-6-14-23)36-33(35-31)25-16-9-15-24(21-25)26-18-10-19-28-27-17-7-8-20-29(27)37-30(26)28;1-3-10-18(11-4-1)25-28-26(19-12-5-2-6-13-19)30-27(29-25)22-16-9-15-21-20-14-7-8-17-23(20)31-24(21)22/h1-21H;1-17H |
| InChIKey | URGFXIBXWDZYKM-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.07 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |