About 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane
1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane (PubChem CID 14495345) has the molecular formula C15H30O3
and a molecular weight of 258.40 g/mol. Its IUPAC name is 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane.
Molecular Properties
| Compound Name | 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane |
| PubChem CID | 14495345 |
| Molecular Formula | C15H30O3 |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane |
| SMILES | C=C(OCC(C)C)C(OCC(C)C)OCC(C)C |
| InChI | InChI=1S/C15H30O3/c1-11(2)8-16-14(7)15(17-9-12(3)4)18-10-13(5)6/h11-13,15H,7-10H2,1-6H3 |
| InChIKey | OKLYWBKQIHMQPO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane?
The IUPAC name of 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane (CID 14495345) is 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane.
What is the SMILES notation for 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane?
The canonical SMILES for 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane is C=C(OCC(C)C)C(OCC(C)C)OCC(C)C.
What is the InChIKey of 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane?
The InChIKey is OKLYWBKQIHMQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3/c1-11(2)8-16-14(7)15(17-9-12(3)4)18-10-13(5)6/h11-13,15H,7-10H2,1-6H3.
What are the key properties of 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane?
1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane has a molecular weight of 258.40 g/mol, XLogP of 3.84, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,2-bis(2-methylpropoxy)prop-2-enoxy]-2-methylpropane is sourced from PubChem (CID 14495345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).