About (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate
(4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate (PubChem CID 144953638) has the molecular formula C14H16FNS
and a molecular weight of 249.35 g/mol. Its IUPAC name is (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate.
Molecular Properties
| Compound Name | (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate |
| PubChem CID | 144953638 |
| Molecular Formula | C14H16FNS |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate |
| SMILES | C=C/C=C(CC)\C(=N/C)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C14H16FNS/c1-4-6-11(5-2)14(16-3)17-13-9-7-12(15)8-10-13/h4,6-10H,1,5H2,2-3H3/b11-6-,16-14+ |
| InChIKey | YDSPPEZUTSHLAO-HKVQIXTNSA-N |
| XLogP | 4.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate?
The IUPAC name of (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate (CID 144953638) is (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate.
What is the SMILES notation for (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate?
The canonical SMILES for (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate is C=C/C=C(CC)\C(=N/C)Sc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate?
The InChIKey is YDSPPEZUTSHLAO-HKVQIXTNSA-N. The full InChI is InChI=1S/C14H16FNS/c1-4-6-11(5-2)14(16-3)17-13-9-7-12(15)8-10-13/h4,6-10H,1,5H2,2-3H3/b11-6-,16-14+.
What are the key properties of (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate?
(4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate has a molecular weight of 249.35 g/mol, XLogP of 4.47, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl) (2Z)-2-ethyl-N-methylpenta-2,4-dienimidothioate is sourced from PubChem (CID 144953638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).