C7H11N3S — CID 14495490
1,5-dimethyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate (PubChem CID 14495490) has the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. Its IUPAC name is 1,5-dimethyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate.
| Compound Name | 1,5-dimethyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate |
|---|---|
| PubChem CID | 14495490 |
| Molecular Formula | C7H11N3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1,5-dimethyl-4-prop-2-enyl-1,2,4-triazol-4-ium-3-thiolate |
| SMILES | C=CC[n+]1c([S-])nn(C)c1C |
| InChI | InChI=1S/C7H11N3S/c1-4-5-10-6(2)9(3)8-7(10)11/h4H,1,5H2,2-3H3 |
| InChIKey | DBOAGCVYHOZJGD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|