C12H17ClFN — CID 144954918
4-[(2Z,4E)-3-chloro-4-fluorohepta-2,4,6-trien-2-yl]piperidine (PubChem CID 144954918) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is 4-[(2Z,4E)-3-chloro-4-fluorohepta-2,4,6-trien-2-yl]piperidine.
| Compound Name | 4-[(2Z,4E)-3-chloro-4-fluorohepta-2,4,6-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 144954918 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-[(2Z,4E)-3-chloro-4-fluorohepta-2,4,6-trien-2-yl]piperidine |
| SMILES | C=C/C=C(F)\C(Cl)=C(/C)C1CCNCC1 |
| InChI | InChI=1S/C12H17ClFN/c1-3-4-11(14)12(13)9(2)10-5-7-15-8-6-10/h3-4,10,15H,1,5-8H2,2H3/b11-4+,12-9- |
| InChIKey | BZNPPDXLIGPWFJ-QGIATPRGSA-N |
| XLogP | 3.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|