C14H18F5N — CID 144954999
4-[(3Z,5E)-4,5-difluoro-3-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1-methylpiperidine (PubChem CID 144954999) has the molecular formula C14H18F5N and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-[(3Z,5E)-4,5-difluoro-3-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1-methylpiperidine.
| Compound Name | 4-[(3Z,5E)-4,5-difluoro-3-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 144954999 |
| Molecular Formula | C14H18F5N |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-[(3Z,5E)-4,5-difluoro-3-(trifluoromethyl)hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
| SMILES | C=C(/C(=C(F)\C(F)=C/C)C(F)(F)F)C1CCN(C)CC1 |
| InChI | InChI=1S/C14H18F5N/c1-4-11(15)13(16)12(14(17,18)19)9(2)10-5-7-20(3)8-6-10/h4,10H,2,5-8H2,1,3H3/b11-4+,13-12- |
| InChIKey | GAWCJHDTFUYEKA-NEFRPEFFSA-N |
| XLogP | 4.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|