C15H20F5N — CID 144955045
4-[(2Z,4Z,6E)-5,7-difluoro-4-(trifluoromethyl)octa-2,4,6-trien-3-yl]-1-methylpiperidine (PubChem CID 144955045) has the molecular formula C15H20F5N and a molecular weight of 309.32 g/mol. Its IUPAC name is 4-[(2Z,4Z,6E)-5,7-difluoro-4-(trifluoromethyl)octa-2,4,6-trien-3-yl]-1-methylpiperidine.
| Compound Name | 4-[(2Z,4Z,6E)-5,7-difluoro-4-(trifluoromethyl)octa-2,4,6-trien-3-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 144955045 |
| Molecular Formula | C15H20F5N |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-[(2Z,4Z,6E)-5,7-difluoro-4-(trifluoromethyl)octa-2,4,6-trien-3-yl]-1-methylpiperidine |
| SMILES | C/C=C(C(=C(F)/C=C(\C)F)\C(F)(F)F)/C1CCN(C)CC1 |
| InChI | InChI=1S/C15H20F5N/c1-4-12(11-5-7-21(3)8-6-11)14(15(18,19)20)13(17)9-10(2)16/h4,9,11H,5-8H2,1-3H3/b10-9+,12-4-,14-13- |
| InChIKey | RXJIFIGEBBHRFT-LPOOCQTCSA-N |
| XLogP | 4.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|