About benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide
benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide (PubChem CID 144955417) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide.
Molecular Properties
| Compound Name | benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide |
| PubChem CID | 144955417 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C)CC(=O)NCC.c1ccccc1 |
| InChI | InChI=1S/C10H15NO.C6H6/c1-4-7-9(5-2)8-10(12)11-6-3;1-2-4-6-5-3-1/h4-5,7H,1-2,6,8H2,3H3,(H,11,12);1-6H/b9-7+; |
| InChIKey | PEMFHNIWZIXKPE-BXTVWIJMSA-N |
| XLogP | 3.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide?
The IUPAC name of benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide (CID 144955417) is benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide.
What is the SMILES notation for benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide?
The canonical SMILES for benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide is C=C/C=C(\C=C)CC(=O)NCC.c1ccccc1.
What is the InChIKey of benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide?
The InChIKey is PEMFHNIWZIXKPE-BXTVWIJMSA-N. The full InChI is InChI=1S/C10H15NO.C6H6/c1-4-7-9(5-2)8-10(12)11-6-3;1-2-4-6-5-3-1/h4-5,7H,1-2,6,8H2,3H3,(H,11,12);1-6H/b9-7+;.
What are the key properties of benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide?
benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide has a molecular weight of 243.35 g/mol, XLogP of 3.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;(3Z)-3-ethenyl-N-ethylhexa-3,5-dienamide is sourced from PubChem (CID 144955417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).