About 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal
1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal (PubChem CID 144955546) has the molecular formula C13H29NO2S
and a molecular weight of 263.45 g/mol. Its IUPAC name is 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal |
| PubChem CID | 144955546 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal |
| SMILES | CC1CCN(C)C1.COC.CSCCCC=O |
| InChI | InChI=1S/C6H13N.C5H10OS.C2H6O/c1-6-3-4-7(2)5-6;1-7-5-3-2-4-6;1-3-2/h6H,3-5H2,1-2H3;4H,2-3,5H2,1H3;1-2H3 |
| InChIKey | DASKUWDBVQTNCE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal?
The IUPAC name of 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal (CID 144955546) is 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal.
What is the SMILES notation for 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal?
The canonical SMILES for 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal is CC1CCN(C)C1.COC.CSCCCC=O.
What is the InChIKey of 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal?
The InChIKey is DASKUWDBVQTNCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C5H10OS.C2H6O/c1-6-3-4-7(2)5-6;1-7-5-3-2-4-6;1-3-2/h6H,3-5H2,1-2H3;4H,2-3,5H2,1H3;1-2H3.
What are the key properties of 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal?
1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal has a molecular weight of 263.45 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolidine;methoxymethane;4-methylsulfanylbutanal is sourced from PubChem (CID 144955546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).