C15H20N2O2 — CID 144955706
(2Z,4E)-4-methyl-2-[methyl-(5-methyl-2-pyridinyl)amino]hepta-2,4-dienoic acid (PubChem CID 144955706) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (2Z,4E)-4-methyl-2-[methyl-(5-methyl-2-pyridinyl)amino]hepta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-4-methyl-2-[methyl-(5-methyl-2-pyridinyl)amino]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144955706 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2Z,4E)-4-methyl-2-[methyl-(5-methyl-2-pyridinyl)amino]hepta-2,4-dienoic acid |
| SMILES | CC/C=C(C)/C=C(/C(=O)O)N(C)c1ccc(C)cn1 |
| InChI | InChI=1S/C15H20N2O2/c1-5-6-11(2)9-13(15(18)19)17(4)14-8-7-12(3)10-16-14/h6-10H,5H2,1-4H3,(H,18,19)/b11-6+,13-9- |
| InChIKey | YPYVEWTYSHIXBS-JODYEUIASA-N |
| XLogP | 3.15 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|