C33H24N4 — CID 144955832
9-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole (PubChem CID 144955832) has the molecular formula C33H24N4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 9-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole.
| Compound Name | 9-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
|---|---|
| PubChem CID | 144955832 |
| Molecular Formula | C33H24N4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 9-cyclohexa-1,5-dien-1-yl-4-(4,6-diphenyl-1,3,5-triazin-2-yl)carbazole |
| SMILES | C1=CC(n2c3ccccc3c3c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cccc32)=CCC1 |
| InChI | InChI=1S/C33H24N4/c1-4-13-23(14-5-1)31-34-32(24-15-6-2-7-16-24)36-33(35-31)27-20-12-22-29-30(27)26-19-10-11-21-28(26)37(29)25-17-8-3-9-18-25/h1-2,4-8,10-22H,3,9H2 |
| InChIKey | ZTHKPPIDMCLNMA-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |