C18H27N3 — CID 144956127
(2Z,4E)-5-ethenyl-6-propyl-3-pyrimidin-2-ylnona-2,4-dien-2-amine (PubChem CID 144956127) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (2Z,4E)-5-ethenyl-6-propyl-3-pyrimidin-2-ylnona-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-5-ethenyl-6-propyl-3-pyrimidin-2-ylnona-2,4-dien-2-amine |
|---|---|
| PubChem CID | 144956127 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (2Z,4E)-5-ethenyl-6-propyl-3-pyrimidin-2-ylnona-2,4-dien-2-amine |
| SMILES | C=C/C(=C\C(=C(/C)N)c1ncccn1)C(CCC)CCC |
| InChI | InChI=1S/C18H27N3/c1-5-9-16(10-6-2)15(7-3)13-17(14(4)19)18-20-11-8-12-21-18/h7-8,11-13,16H,3,5-6,9-10,19H2,1-2,4H3/b15-13+,17-14- |
| InChIKey | VFLAGXUNSOBPCH-FBWUVJDOSA-N |
| XLogP | 4.50 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|