C19H25BrN2O2 — CID 144956361
N-(6-bromo-3-methylquinolin-4-yl)-N-(oxan-4-yl)acetamide;ethane (PubChem CID 144956361) has the molecular formula C19H25BrN2O2 and a molecular weight of 393.33 g/mol. Its IUPAC name is N-(6-bromo-3-methylquinolin-4-yl)-N-(oxan-4-yl)acetamide;ethane.
| Compound Name | N-(6-bromo-3-methylquinolin-4-yl)-N-(oxan-4-yl)acetamide;ethane |
|---|---|
| PubChem CID | 144956361 |
| Molecular Formula | C19H25BrN2O2 |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-(6-bromo-3-methylquinolin-4-yl)-N-(oxan-4-yl)acetamide;ethane |
| SMILES | CC.CC(=O)N(c1c(C)cnc2ccc(Br)cc12)C1CCOCC1 |
| InChI | InChI=1S/C17H19BrN2O2.C2H6/c1-11-10-19-16-4-3-13(18)9-15(16)17(11)20(12(2)21)14-5-7-22-8-6-14;1-2/h3-4,9-10,14H,5-8H2,1-2H3;1-2H3 |
| InChIKey | NUGPQAVRXLTFKT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |