C22H35NO — CID 144956484
N-ethenylpropan-1-imine;[2-ethyl-1-methyl-3-[(4-methylphenyl)methyl]cyclopentyl]methanol (PubChem CID 144956484) has the molecular formula C22H35NO and a molecular weight of 329.53 g/mol. Its IUPAC name is N-ethenylpropan-1-imine;[2-ethyl-1-methyl-3-[(4-methylphenyl)methyl]cyclopentyl]methanol.
| Compound Name | N-ethenylpropan-1-imine;[2-ethyl-1-methyl-3-[(4-methylphenyl)methyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 144956484 |
| Molecular Formula | C22H35NO |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | N-ethenylpropan-1-imine;[2-ethyl-1-methyl-3-[(4-methylphenyl)methyl]cyclopentyl]methanol |
| SMILES | C=C/N=C/CC.CCC1C(Cc2ccc(C)cc2)CCC1(C)CO |
| InChI | InChI=1S/C17H26O.C5H9N/c1-4-16-15(9-10-17(16,3)12-18)11-14-7-5-13(2)6-8-14;1-3-5-6-4-2/h5-8,15-16,18H,4,9-12H2,1-3H3;4-5H,2-3H2,1H3/b;6-5+ |
| InChIKey | SUKVJOUVOSTIFQ-MXDQRGINSA-N |
| XLogP | 5.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|