About 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen
2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen (PubChem CID 144956531) has the molecular formula C12H25NO7
and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen.
Molecular Properties
| Compound Name | 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen |
| PubChem CID | 144956531 |
| Molecular Formula | C12H25NO7 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen |
| SMILES | CC(C)(C)O.CC1(C(=O)OCCNO)COC(=O)OC1.[H][H] |
| InChI | InChI=1S/C8H13NO6.C4H10O.H2/c1-8(4-14-7(11)15-5-8)6(10)13-3-2-9-12;1-4(2,3)5;/h9,12H,2-5H2,1H3;5H,1-3H3;1H |
| InChIKey | WKWYIZMKZLDZMI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen?
The IUPAC name of 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen (CID 144956531) is 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen.
What is the SMILES notation for 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen?
The canonical SMILES for 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen is CC(C)(C)O.CC1(C(=O)OCCNO)COC(=O)OC1.[H][H].
What is the InChIKey of 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen?
The InChIKey is WKWYIZMKZLDZMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO6.C4H10O.H2/c1-8(4-14-7(11)15-5-8)6(10)13-3-2-9-12;1-4(2,3)5;/h9,12H,2-5H2,1H3;5H,1-3H3;1H.
What are the key properties of 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen?
2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen has a molecular weight of 295.33 g/mol, XLogP of 0.70, 4 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxyamino)ethyl 5-methyl-2-oxo-1,3-dioxane-5-carboxylate;2-methylpropan-2-ol;molecular hydrogen is sourced from PubChem (CID 144956531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).