About [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate
[4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate (PubChem CID 14495709) has the molecular formula C27H29F3N2O3
and a molecular weight of 486.53 g/mol. Its IUPAC name is [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate.
Molecular Properties
| Compound Name | [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate |
| PubChem CID | 14495709 |
| Molecular Formula | C27H29F3N2O3 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate |
| SMILES | CCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(CCOCC)c(F)c3F)c(F)c2)nc1 |
| InChI | InChI=1S/C27H29F3N2O3/c1-3-5-6-7-8-18-16-31-26(32-17-18)20-9-11-21(22(28)15-20)27(33)35-23-12-10-19(13-14-34-4-2)24(29)25(23)30/h9-12,15-17H,3-8,13-14H2,1-2H3 |
| InChIKey | PVGJBCVAHBUCFK-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate?
The IUPAC name of [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate (CID 14495709) is [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate.
What is the SMILES notation for [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate?
The canonical SMILES for [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate is CCCCCCc1cnc(-c2ccc(C(=O)Oc3ccc(CCOCC)c(F)c3F)c(F)c2)nc1.
What is the InChIKey of [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate?
The InChIKey is PVGJBCVAHBUCFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29F3N2O3/c1-3-5-6-7-8-18-16-31-26(32-17-18)20-9-11-21(22(28)15-20)27(33)35-23-12-10-19(13-14-34-4-2)24(29)25(23)30/h9-12,15-17H,3-8,13-14H2,1-2H3.
What are the key properties of [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate?
[4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate has a molecular weight of 486.53 g/mol, XLogP of 6.48, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-ethoxyethyl)-2,3-difluorophenyl] 2-fluoro-4-(5-hexylpyrimidin-2-yl)benzoate is sourced from PubChem (CID 14495709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).