C25H33N3O — CID 144957465
(2S,3S)-3-acetyl-N'-methyl-2-[[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)phenyl]methyl]hexanimidamide (PubChem CID 144957465) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (2S,3S)-3-acetyl-N'-methyl-2-[[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)phenyl]methyl]hexanimidamide.
| Compound Name | (2S,3S)-3-acetyl-N'-methyl-2-[[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)phenyl]methyl]hexanimidamide |
|---|---|
| PubChem CID | 144957465 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (2S,3S)-3-acetyl-N'-methyl-2-[[4-(1,2,3,4-tetrahydroisoquinolin-7-yl)phenyl]methyl]hexanimidamide |
| SMILES | CCC[C@H](C(C)=O)[C@H](Cc1ccc(-c2ccc3c(c2)CNCC3)cc1)/C(N)=N/C |
| InChI | InChI=1S/C25H33N3O/c1-4-5-23(17(2)29)24(25(26)27-3)14-18-6-8-19(9-7-18)21-11-10-20-12-13-28-16-22(20)15-21/h6-11,15,23-24,28H,4-5,12-14,16H2,1-3H3,(H2,26,27)/t23-,24+/m1/s1 |
| InChIKey | QBBYCNSBYHRUOP-RPWUZVMVSA-N |
| XLogP | 4.15 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|